EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | CC[C@@H]1C=CC(=O)[C@@H]1/C=C/[C@H](O)C/C=C\C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H30O4/c1-2-18-14-17-21(24)20(18)16-15-19(23)12-10-8-6-4-3-5-7-9-11-13-22(25)26/h3-4,7-10,14-20,23H,2,5-6,11-13H2,1H3,(H,25,26)/b4-3-,9-7-,10-8-,16-15+/t18-,19-,20-/m1/s1 |
| InChIKey | UVLNGPRKWCOOFQ-JYJSRBJYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | inflorescence (BTO:0000628) | MetaboLights (MTBLS6032) | Strain: Cannabis sativa var. DMG265 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-epi-13-A4-NeuroP (CHEBI:196992) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (4Z,7Z,10Z,13R,14E)-15-[(1R,2R)-2-ethyl-5-oxocyclopent-3-en-1-yl]-13-hydroxypentadeca-4,7,10,14-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113370442 | ChemSpider |
| LMFA04010427 | LIPID MAPS |