EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O4 |
| Net Charge | 0 |
| Average Mass | 320.429 |
| Monoisotopic Mass | 320.19876 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@@]1(CC[C@]1([H])[C@H](C(=O)O)C[C@@H](O)C[C@@]21C)[C@@H](O)C3=C |
| InChI | InChI=1S/C19H28O4/c1-10-11-3-4-15-18(2)9-12(20)7-13(17(22)23)14(18)5-6-19(15,8-11)16(10)21/h11-16,20-21H,1,3-9H2,2H3,(H,22,23)/t11-,12-,13-,14-,15+,16+,18-,19-/m1/s1 |
| InChIKey | YRHWUYVCCPXYMB-JIMOHSCASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coffea canephora (ncbitaxon:49390) | - | PubMed (36094050) | Isolated from trunks. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atractyligenin (CHEBI:196975) has role plant metabolite (CHEBI:76924) |
| atractyligenin (CHEBI:196975) is a ent-kaurane diterpenoid (CHEBI:36760) |
| atractyligenin (CHEBI:196975) is a carbotetracyclic compound (CHEBI:177332) |
| atractyligenin (CHEBI:196975) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| atractyligenin (CHEBI:196975) is a tetracyclic diterpenoid (CHEBI:52557) |
| Incoming Relation(s) |
| atractyligenin 2-glucuronide (CHEBI:196976) has functional parent atractyligenin (CHEBI:196975) |
| IUPAC Name |
|---|
| (2R,4R,4aR,6aR,7S,9R,11aS,11bR)-2,7-dihydroxy-11b-methyl-8-methylidenetetradecahydro-6a,9-methanocyclohepta[a]naphthalene-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| (2β,4α,15α)-2,15-dihydroxy-19-norkaur-16-en-18-oic acid | ChEBI |
| (4α)-2β,15α-dihydroxy-19-norkaur-16-en-18-oic acid | ChEBI |
| atractyligenine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061114 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:10391-47-6 | ChEBI |
| Citations |
|---|