EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O2 |
| Net Charge | 0 |
| Average Mass | 190.242 |
| Monoisotopic Mass | 190.09938 |
| SMILES | Cc1ccccc1/C=C/CCC(=O)O |
| InChI | InChI=1S/C12H14O2/c1-10-6-2-3-7-11(10)8-4-5-9-12(13)14/h2-4,6-8H,5,9H2,1H3,(H,13,14)/b8-4+ |
| InChIKey | DRZNYKPVRLVHJG-XBXARRHUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces globisporus C-1027 (ncbitaxon:1172567) | - | PubMed (35992673) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-5-(2-methylphenyl)-4-pentenoic acid (CHEBI:196951) is a 5-(2-methylphenyl)-4-pentenoic acid (CHEBI:197367) |
| IUPAC Name |
|---|
| (4E)-5-(2-methylphenyl)pent-4-enoic acid |
| Synonyms | Source |
|---|---|
| E-5-(2-methylphenyl)-4-pentenoic acid | ChEBI |
| (E)-5-(2-methylphenyl)pent-4-enoic acid | ChEBI |
| Citations |
|---|