EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | Cc1ccccc1/C=C/CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H30O2/c1-18-14-12-13-16-19(18)15-10-8-6-4-2-3-5-7-9-11-17-20(21)22/h10,12-16H,2-9,11,17H2,1H3,(H,21,22)/b15-10+ |
| InChIKey | LRVODNVNRNARGX-XNTDXEJSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces chumphonensis (ncbitaxon:1214925) | - | PubMed (35447932) | Strain: SCSIO15079 |
| Streptomyces globisporus C-1027 (ncbitaxon:1172567) | - | PubMed (35992673) | |
| Streptomyces sp. (ncbitaxon:1931) | - | DOI (10.1080/10286020.2019.1700230) | Strain: QHA10 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| globisporamic acid (CHEBI:196950) has role bacterial metabolite (CHEBI:76969) |
| globisporamic acid (CHEBI:196950) has role marine metabolite (CHEBI:76507) |
| globisporamic acid (CHEBI:196950) is a monocarboxylic acid (CHEBI:25384) |
| globisporamic acid (CHEBI:196950) is a olefinic compound (CHEBI:78840) |
| globisporamic acid (CHEBI:196950) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| (12E)-13-(2-methylphenyl)tridec-12-enoic acid |
| Synonyms | Source |
|---|---|
| (12E)-13-(2-methylphenyl)-12-tridecenoic acid | ChEBI |
| (E)-13-(2-methylphenyl)-12-tridecenoic acid | ChEBI |
| E-13-(2-methylphenyl)-12-tridecenoic acid | ChEBI |
| (E)-13-(2-methylphenyl)tridec-12-enoic acid | ChEBI |
| (E)-13-(o-tolyl)tridec-12-enoic acid | ChEBI |
| Citations |
|---|