EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O3 |
| Net Charge | 0 |
| Average Mass | 300.483 |
| Monoisotopic Mass | 300.26645 |
| SMILES | CCCCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C18H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h17,19H,2-16H2,1H3,(H,20,21) |
| InChIKey | KIHBGTRZFAVZRV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (13661981) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyoctadecanoic acid (CHEBI:19660) has role human metabolite (CHEBI:77746) |
| 2-hydroxyoctadecanoic acid (CHEBI:19660) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxyoctadecanoic acid (CHEBI:19660) is a hydroxyoctadecanoic acid (CHEBI:24747) |
| 2-hydroxyoctadecanoic acid (CHEBI:19660) is conjugate acid of 2-hydroxyoctadecanoate (CHEBI:76724) |
| Incoming Relation(s) |
| N-2-hydroxystearoylsphingosine (CHEBI:76754) has functional parent 2-hydroxyoctadecanoic acid (CHEBI:19660) |
| 2-hydroxystearoyl-CoA (CHEBI:74138) has functional parent 2-hydroxyoctadecanoic acid (CHEBI:19660) |
| N-(2R-hydroxyoctadecanoyl)-4E,8Z-octadecasphingadienine (CHEBI:189685) has functional parent 2-hydroxyoctadecanoic acid (CHEBI:19660) |
| (R)-2-hydroxyoctadecanoic acid (CHEBI:15913) is a 2-hydroxyoctadecanoic acid (CHEBI:19660) |
| (S)-2-hydroxyoctadecanoic acid (CHEBI:18129) is a 2-hydroxyoctadecanoic acid (CHEBI:19660) |
| 2-hydroxyoctadecanoate (CHEBI:76724) is conjugate base of 2-hydroxyoctadecanoic acid (CHEBI:19660) |
| IUPAC Name |
|---|
| 2-hydroxyoctadecanoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxystearic acid | ChEBI |
| α-hydroxyoctadecanoic acid | ChEBI |
| α-hydroxystearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000120 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1791479 | Reaxys |
| CAS:629-22-1 | ChemIDplus |
| Citations |
|---|