EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | C[C@]12CCC(=O)C(O)=C1CCC1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C19H28O3/c1-18-10-8-15(20)17(22)14(18)4-3-11-12-5-6-16(21)19(12,2)9-7-13(11)18/h11-13,16,21-22H,3-10H2,1-2H3/t11?,12?,13?,16-,18+,19-/m0/s1 |
| InChIKey | BQOIJSIMMIDHMO-XRJYYLNASA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7a-Hydroxytestosterone (CHEBI:196340) has role androgen (CHEBI:50113) |
| 7a-Hydroxytestosterone (CHEBI:196340) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (10R,13S,17S)-4,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| C05291 | KEGG COMPOUND |
| HMDB0003956 | HMDB |