EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14O6 |
| Net Charge | 0 |
| Average Mass | 326.304 |
| Monoisotopic Mass | 326.07904 |
| SMILES | COc1cc2oc(-c3ccc4c(c3)OCO4)cc(=O)c2cc1OC |
| InChI | InChI=1S/C18H14O6/c1-20-16-6-11-12(19)7-14(24-15(11)8-17(16)21-2)10-3-4-13-18(5-10)23-9-22-13/h3-8H,9H2,1-2H3 |
| InChIKey | HCZZPIBXVSKNNL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| milletenin C (CHEBI:196321) has role plant metabolite (CHEBI:76924) |
| milletenin C (CHEBI:196321) is a aromatic ether (CHEBI:35618) |
| milletenin C (CHEBI:196321) is a benzodioxole (CHEBI:38733) |
| milletenin C (CHEBI:196321) is a chromones (CHEBI:23238) |
| milletenin C (CHEBI:196321) is a dimethoxyflavone (CHEBI:23798) |
| IUPAC Name |
|---|
| 2-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(1,3-benzodioxol-5-yl)-6,7-dimethoxychromen-4-one | ChEBI |
| 2-(2H-1,3-benzodioxol-5-yl)-6,7-dimethoxy-4H-1-benzopyran-4-one | IUPAC |
| 6,7-dimethoxy-3',4'-methylenedioxyflavone | LIPID MAPS |
| 2-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-4H-1-benzopyran-4-one | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| 24843179 | ChemSpider |
| LMPK12110067 | LIPID MAPS |
| C00003999 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:55303-89-4 | KNApSAcK |
| Citations |
|---|