EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | CCCCCCc1ccc(CCc2ccc(O)c(OC)c2)o1 |
| InChI | InChI=1S/C19H26O3/c1-3-4-5-6-7-16-11-12-17(22-16)10-8-15-9-13-18(20)19(14-15)21-2/h9,11-14,20H,3-8,10H2,1-2H3 |
| InChIKey | WZHSIDQBPQYZNL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Hexyl-5-[2-(4-hydroxy-3-methoxyphenyl)ethyl]furan (CHEBI:196276) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 4-[2-(5-hexyluran-2-yl)ethyl]-2-methoxyphenol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040927 | HMDB |
| 30777520 | ChemSpider |