EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | O=C(O)C(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,10-11H,5H2,(H,12,13) |
| InChIKey | JVGVDSSUAVXRDY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) has functional parent rac-lactic acid (CHEBI:28358) |
| 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) has role bacterial metabolite (CHEBI:76969) |
| 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) has role human metabolite (CHEBI:77746) |
| 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) is a 2-hydroxy carboxylic acid (CHEBI:52618) |
| 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) is a phenols (CHEBI:33853) |
| 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) is conjugate acid of 3-(4-hydroxyphenyl)lactate (CHEBI:36659) |
| Incoming Relation(s) |
| (R)-3-(4-hydroxyphenyl)lactic acid (CHEBI:16003) is a 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) |
| 3-(4-hydroxyphenyl)lactate (CHEBI:36659) is conjugate base of 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(4-hydroxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-3-(4-hydroxyphenyl)propanoate | KEGG COMPOUND |
| 2-Hydroxy-3-(p-hydroxyphenyl)propionic acid | ChemIDplus |
| 4-Hydroxyphenyllactic acid | ChemIDplus |
| beta-(4-Hydroxyphenyl)lactic acid | ChemIDplus |
| beta-(p-Hydroxyphenyl)lactic acid | ChemIDplus |
| p-Hydroxyphenyl lactic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4-HYDROXYPHENYLLACTATE | MetaCyc |
| C03672 | KEGG COMPOUND |
| HMDB0000755 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2693719 | Reaxys |
| CAS:306-23-0 | ChemIDplus |
| Citations |
|---|