EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5FO2 |
| Net Charge | 0 |
| Average Mass | 140.113 |
| Monoisotopic Mass | 140.02736 |
| SMILES | O=C(O)c1ccccc1F |
| InChI | InChI=1S/C7H5FO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | NSTREUWFTAOOKS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-fluorobenzoic acid (CHEBI:19577) is a 2-halobenzoic acid (CHEBI:70862) |
| 2-fluorobenzoic acid (CHEBI:19577) is a fluorobenzoic acid (CHEBI:24071) |
| 2-fluorobenzoic acid (CHEBI:19577) is conjugate acid of 2-fluorobenzoate (CHEBI:27839) |
| Incoming Relation(s) |
| 2-fluorobenzoyl-CoA (CHEBI:27490) has functional parent 2-fluorobenzoic acid (CHEBI:19577) |
| 2-fluorobenzoate (CHEBI:27839) is conjugate base of 2-fluorobenzoic acid (CHEBI:19577) |
| IUPAC Name |
|---|
| 2-fluorobenzoic acid |
| Synonyms | Source |
|---|---|
| 2-Fluorobenzoic acid | KEGG COMPOUND |
| o-Fluorobenzoic acid | ChemIDplus |
| ortho-Fluorobenzoic acid | NIST Chemistry WebBook |
| Citations |
|---|