EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 168.624 |
| Monoisotopic Mass | 168.06656 |
| SMILES | Cl.NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2.ClH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H/t4-;/m0./s1 |
| InChIKey | GGTYBZJRPHEQDG-WCCKRBBISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Ornithine monochlorohydrate/ornithine (CHEBI:195690) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2,5-diaminopentanoic acid;hydrochloride |
| Manual Xrefs | Databases |
|---|---|
| 69117 | ChemSpider |