EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H28O |
| Net Charge | 0 |
| Average Mass | 200.366 |
| Monoisotopic Mass | 200.21402 |
| SMILES | CCCCCCCCCC(O)CCC |
| InChI | InChI=1S/C13H28O/c1-3-5-6-7-8-9-10-12-13(14)11-4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | VHNLHPIEIIHMHH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mandragora autumnalis (ncbitaxon:389206) | fruit (BTO:0000486) | DOI (10.1002/cbdv.201900345) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridecan-4-ol (CHEBI:195626) has role plant metabolite (CHEBI:76924) |
| tridecan-4-ol (CHEBI:195626) has role volatile oil component (CHEBI:27311) |
| tridecan-4-ol (CHEBI:195626) is a secondary alcohol (CHEBI:35681) |
| tridecan-4-ol (CHEBI:195626) is a tridecanol (CHEBI:195620) |
| IUPAC Name |
|---|
| tridecan-4-ol |
| Synonyms | Source |
|---|---|
| 4-tridecanol | NIST Chemistry WebBook |
| 4-hydroxytridecane | ChEBI |
| 4-tridecyl alcohol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00052725 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:26215-92-9 | NIST Chemistry WebBook |
| Citations |
|---|