EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H28O |
| Net Charge | 0 |
| Average Mass | 200.366 |
| Monoisotopic Mass | 200.21402 |
| SMILES | CCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C13H28O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h13-14H,3-12H2,1-2H3 |
| InChIKey | HKOLRKVMHVYNGG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Passiflora edulis (ncbitaxon:78168) | - | DOI (10.1080/10412905.1997.9699469) | |
| Zanthoxylum leprieurii (ncbitaxon:992815) | trunk bark (BTO:0001494) | PubMed (32369948) |
| Roles Classification |
|---|
| Biological Roles: | insect attractant A chemical that attracts insects. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridecan-2-ol (CHEBI:195621) has role insect attractant (CHEBI:24850) |
| tridecan-2-ol (CHEBI:195621) has role pheromone (CHEBI:26013) |
| tridecan-2-ol (CHEBI:195621) has role plant metabolite (CHEBI:76924) |
| tridecan-2-ol (CHEBI:195621) is a secondary alcohol (CHEBI:35681) |
| tridecan-2-ol (CHEBI:195621) is a tridecanol (CHEBI:195620) |
| IUPAC Name |
|---|
| tridecan-2-ol |
| Synonyms | Source |
|---|---|
| 1-methyl-1-dodecanol | ChEBI |
| 1-methyldodecanol | ChEBI |
| 1-methyldodecyl alcohol | ChEBI |
| 2-hydroxytridecane | NIST Chemistry WebBook |
| 2-tridecanol | NIST Chemistry WebBook |
| 2-tridecyl alcohol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00060265 | KNApSAcK |
| LMFA05000523 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720217 | Reaxys |
| CAS:1653-31-2 | NIST Chemistry WebBook |
| Citations |
|---|