EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:195611 - undecan-4-ol
| Formula | C11H24O |
| Net Charge | 0 |
| Average Mass | 172.312 |
| Monoisotopic Mass | 172.18272 |
| SMILES | CCCCCCCC(O)CCC |
| InChI | InChI=1S/C11H24O/c1-3-5-6-7-8-10-11(12)9-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | FNORHVDKJWGANC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Capillipedium parviflorum (ncbitaxon:79829) | - | PubMed (22077331) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| undecan-4-ol (CHEBI:195611) has role plant metabolite (CHEBI:76924) |
| undecan-4-ol (CHEBI:195611) has role volatile oil component (CHEBI:27311) |
| undecan-4-ol (CHEBI:195611) is a secondary alcohol (CHEBI:35681) |
| undecan-4-ol (CHEBI:195611) is a undecanol (CHEBI:195608) |
| IUPAC Name |
|---|
| undecan-4-ol |
| Synonyms | Source |
|---|---|
| undecanol-4 | NIST Chemistry WebBook |
| 4-undecanol | NIST Chemistry WebBook |
| 4-hydroxyundecane | ChEBI |
| 4-hendecanol | ChEBI |
| heptylpropylcarbinol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1698387 | Reaxys |
| CAS:4272-06-4 | NIST Chemistry WebBook |
| Citations |
|---|