EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20O |
| Net Charge | 0 |
| Average Mass | 144.258 |
| Monoisotopic Mass | 144.15142 |
| SMILES | CCCCC(O)CCCC |
| InChI | InChI=1S/C9H20O/c1-3-5-7-9(10)8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | FCBBRODPXVPZAH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metamasius hemipterus (ncbitaxon:206459) | - | PubMed (8733610) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonan-5-ol (CHEBI:195606) has role animal metabolite (CHEBI:75767) |
| nonan-5-ol (CHEBI:195606) has role pheromone (CHEBI:26013) |
| nonan-5-ol (CHEBI:195606) is a nonanol (CHEBI:195604) |
| nonan-5-ol (CHEBI:195606) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| nonan-5-ol |
| Synonyms | Source |
|---|---|
| 5-nonyl alcohol | ChEBI |
| 5-hydroxynonane | ChEBI |
| 5-nonanol | ChEBI |
| dibutylcarbinol | ChEBI |
| 1-butylpentyl alcohol | ChEBI |
| dibutyl carbinol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA05000508 | LIPID MAPS |
| US2010324310 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1733552 | Reaxys |
| CAS:623-93-8 | NIST Chemistry WebBook |
| Citations |
|---|