EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:195605 - nonan-4-ol
| Formula | C9H20O |
| Net Charge | 0 |
| Average Mass | 144.258 |
| Monoisotopic Mass | 144.15142 |
| SMILES | CCCCCC(O)CCC |
| InChI | InChI=1S/C9H20O/c1-3-5-6-8-9(10)7-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | IXUOEGRSQCCEHB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Capillipedium parviflorum (ncbitaxon:79829) | aerial part (BTO:0001658) | PubMed (15279990 ) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonan-4-ol (CHEBI:195605) has role plant metabolite (CHEBI:76924) |
| nonan-4-ol (CHEBI:195605) has role rat metabolite (CHEBI:86264) |
| nonan-4-ol (CHEBI:195605) has role volatile oil component (CHEBI:27311) |
| nonan-4-ol (CHEBI:195605) is a nonanol (CHEBI:195604) |
| nonan-4-ol (CHEBI:195605) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| nonan-4-ol |
| Synonyms | Source |
|---|---|
| 4-nonyl alcohol | ChEBI |
| 4-hydroxynonane | ChEBI |
| 4-nonanol | ChEBI |
| amylpropylcarbinol | ChEBI |
| pentylpropylcarbinol | ChEBI |
| propylamylcarbinol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1719438 | Reaxys |
| CAS:5932-79-6 | NIST Chemistry WebBook |
| Citations |
|---|