EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:195603 - decan-5-ol
| Formula | C10H22O |
| Net Charge | 0 |
| Average Mass | 158.285 |
| Monoisotopic Mass | 158.16707 |
| SMILES | CCCCCC(O)CCCC |
| InChI | InChI=1S/C10H22O/c1-3-5-7-9-10(11)8-6-4-2/h10-11H,3-9H2,1-2H3 |
| InChIKey | SZMNDOUFZGODBR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystoseira corniculata (WORMS:145513) | - | PubMed (36296722) |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decan-5-ol (CHEBI:195603) has role algal metabolite (CHEBI:84735) |
| decan-5-ol (CHEBI:195603) has role marine metabolite (CHEBI:76507) |
| decan-5-ol (CHEBI:195603) is a decanol (CHEBI:195598) |
| decan-5-ol (CHEBI:195603) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| decan-5-ol |
| Synonyms | Source |
|---|---|
| 5-decanol | ChEBI |
| 5-hydroxydecane | ChEBI |
| amylbutylcarbinol | ChEBI |
| 5-decyl alcohol | ChEBI |
| butylpentylcarbinol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1735187 | Reaxys |
| CAS:5205-34-5 | NIST Chemistry WebBook |
| Citations |
|---|