EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N5O |
| Net Charge | 0 |
| Average Mass | 333.395 |
| Monoisotopic Mass | 333.15896 |
| SMILES | Cc1ccccc1N=Nc1ccc(NC(=O)c2ccnn2C)c(C)c1 |
| InChI | InChI=1S/C19H19N5O/c1-13-6-4-5-7-17(13)23-22-15-8-9-16(14(2)12-15)21-19(25)18-10-11-20-24(18)3/h4-12H,1-3H3,(H,21,25) |
| InChIKey | LKTNEXPODAWWFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | aryl hydrocarbon receptor antagonist An antagonist that binds to and activates aryl hydrocarbon receptors (AhRs). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CH-223191 (CHEBI:195599) has functional parent 1-methyl-pyrazole-5-carboxylic acid (CHEBI:74737) |
| CH-223191 (CHEBI:195599) has role aryl hydrocarbon receptor antagonist (CHEBI:76998) |
| CH-223191 (CHEBI:195599) is a aromatic amide (CHEBI:62733) |
| CH-223191 (CHEBI:195599) is a monoazo compound (CHEBI:48959) |
| CH-223191 (CHEBI:195599) is a pyrazoles (CHEBI:26410) |
| CH-223191 (CHEBI:195599) is a secondary carboxamide (CHEBI:140325) |
| CH-223191 (CHEBI:195599) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 1-methyl-N-{2-methyl-4-[(2-methylphenyl)diazenyl]phenyl}-1H-pyrazole-5-carboxamide |
| Synonyms | Source |
|---|---|
| 2-methyl-2H-pyrazole-3-carboxylic acid (2-methyl-4-o-tolylazo-phenyl)-amide | ChEBI |
| 2-methyl-2H-pyrazole-3-carboxylic acid (2-methyl-4-o-tolylazophenyl)amide | SUBMITTER |
| 2-methyl-N-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]pyrazole-3-carboxamide | ChEBI |
| CH 223191 | ChEBI |
| CH223191 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-37014 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:301326-22-7 | SUBMITTER |
| Citations |
|---|