EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7N3 |
| Net Charge | 0 |
| Average Mass | 109.132 |
| Monoisotopic Mass | 109.06400 |
| SMILES | Nc1cccnc1N |
| InChI | InChI=1S/C5H7N3/c6-4-2-1-3-8-5(4)7/h1-3H,6H2,(H2,7,8) |
| InChIKey | ZZYXNRREDYWPLN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera (ncbitaxon:7460) | ovary (BTO:0000975) | MetaboLights (MTBLS7576) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-Diaminopyridine (CHEBI:195591) is a aminopyridine (CHEBI:38207) |
| IUPAC Name |
|---|
| pyridine-2,3-diamine |