EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33NO12 |
| Net Charge | 0 |
| Average Mass | 551.545 |
| Monoisotopic Mass | 551.20028 |
| SMILES | COc1cc(/C=C\C(=O)O[C@H]2[C@H](O[C@@H]3C[C@H](OC)[C@H](OC)[C@@H](O)/C3=C/C#N)O[C@H](CO)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C26H33NO12/c1-34-17-10-13(4-6-15(17)29)5-7-20(30)39-25-23(33)22(32)19(12-28)38-26(25)37-16-11-18(35-2)24(36-3)21(31)14(16)8-9-27/h4-8,10,16,18-19,21-26,28-29,31-33H,11-12H2,1-3H3/b7-5-,14-8+/t16-,18+,19-,21+,22-,23+,24+,25-,26-/m1/s1 |
| InChIKey | GWXJMPVVJCHQIB-NSQTZXJSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera (ncbitaxon:7460) | ovary (BTO:0000975) | MetaboLights (MTBLS7576) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Simmondsin 2'-ferulate (CHEBI:195589) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [(2R,3R,4S,5S,6R)-2-[(1R,2Z,3S,4R,5S)-2-(cyanomethylidene)-3-hydroxy-4,5-dimethoxycyclohexyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] (Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 4946711 | ChemSpider |