EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N3O5 |
| Net Charge | 0 |
| Average Mass | 305.290 |
| Monoisotopic Mass | 305.10117 |
| SMILES | CCN(CC)C(=O)/C(C#N)=C\c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N3O5/c1-3-16(4-2)14(20)10(8-15)5-9-6-11(17(21)22)13(19)12(18)7-9/h5-7,18-19H,3-4H2,1-2H3/b10-5- |
| InChIKey | JRURYQJSLYLRLN-YHYXMXQVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera (ncbitaxon:7460) | ovary (BTO:0000975) | MetaboLights (MTBLS7576) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cis-Entacapone (CHEBI:195585) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (Z)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 10608657 | ChemSpider |