EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21N5O4 |
| Net Charge | 0 |
| Average Mass | 275.309 |
| Monoisotopic Mass | 275.15935 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C10H21N5O4/c1-5(16)7(9(18)19)15-8(17)6(11)3-2-4-14-10(12)13/h5-7,16H,2-4,11H2,1H3,(H,15,17)(H,18,19)(H4,12,13,14)/t5-,6+,7+/m1/s1 |
| InChIKey | XNSKSTRGQIPTSE-VQVTYTSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera (ncbitaxon:7460) | ovary (BTO:0000975) | MetaboLights (MTBLS7576) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arginylthreonine (CHEBI:195584) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S,3R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 128430686 | ChemSpider |
| HMDB0028719 | HMDB |