EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21ClN2O8 |
| Net Charge | 0 |
| Average Mass | 464.858 |
| Monoisotopic Mass | 464.09864 |
| SMILES | [H][C@]12C[C@@]3([H])C(N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C(O)c1c(O)ccc(Cl)c1C2O |
| InChI | InChI=1S/C21H21ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-27,30,32H,5H2,1-2H3,(H2,23,31)/t6-,7-,14?,15?,21-/m0/s1 |
| InChIKey | GUXHBMASAHGULD-FOMFVERFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera (ncbitaxon:7460) | ovary (BTO:0000975) | MetaboLights (MTBLS7576) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4aS,5aS,12aS)-7-chloro-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboximidic acid (CHEBI:195583) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| (4aS,5aS,12aR)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |