EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21Cl2FN4O3 |
| Net Charge | 0 |
| Average Mass | 491.350 |
| Monoisotopic Mass | 490.09747 |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C23H21Cl2FN4O3/c1-3-20(31)30-8-6-13(7-9-30)33-19-10-14-17(11-18(19)32-2)27-12-28-23(14)29-16-5-4-15(24)21(25)22(16)26/h3-5,10-13H,1,6-9H2,2H3,(H,27,28,29) |
| InChIKey | LPFWVDIFUFFKJU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poziotinib (CHEBI:195559) has role antineoplastic agent (CHEBI:35610) |
| poziotinib (CHEBI:195559) has role apoptosis inducer (CHEBI:68495) |
| poziotinib (CHEBI:195559) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| poziotinib (CHEBI:195559) is a N-acylpiperidine (CHEBI:48591) |
| poziotinib (CHEBI:195559) is a acrylamides (CHEBI:22216) |
| poziotinib (CHEBI:195559) is a aromatic ether (CHEBI:35618) |
| poziotinib (CHEBI:195559) is a dichlorobenzene (CHEBI:23697) |
| poziotinib (CHEBI:195559) is a diether (CHEBI:46786) |
| poziotinib (CHEBI:195559) is a monofluorobenzenes (CHEBI:83575) |
| poziotinib (CHEBI:195559) is a quinazolines (CHEBI:38530) |
| poziotinib (CHEBI:195559) is a secondary amino compound (CHEBI:50995) |
| poziotinib (CHEBI:195559) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 1-(4-{[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy}piperidin-1-yl)prop-2-en-1-one |
| INNs | Source |
|---|---|
| poziotinib | WHO MedNet |
| poziotinib | WHO MedNet |
| poziotinib | WHO MedNet |
| poziotinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-[4-[[4-[(3,4-dichloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl]oxy]-1-piperidinyl]-2-propen-1-one | ChEBI |
| HM 781-36B | DrugBank |
| HM-781-36B | DrugBank |
| HM781-36B | ChEBI |
| NOV-1201 | ChEBI |
| NOV 120101 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 30687714 | ChemSpider |
| D12229 | KEGG DRUG |
| DB12114 | DrugBank |
| Poziotinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1092364-38-9 | DrugBank |
| Citations |
|---|