EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H34F2N6O2 |
| Net Charge | 0 |
| Average Mass | 560.649 |
| Monoisotopic Mass | 560.27113 |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3nnc4ccc(Cc5cc(F)cc(F)c5)cc34)c(NC3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C31H34F2N6O2/c1-38-8-10-39(11-9-38)25-3-4-26(29(19-25)34-24-6-12-41-13-7-24)31(40)35-30-27-17-20(2-5-28(27)36-37-30)14-21-15-22(32)18-23(33)16-21/h2-5,15-19,24,34H,6-14H2,1H3,(H2,35,36,37,40) |
| InChIKey | HAYYBYPASCDWEQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| entrectinib (CHEBI:195558) has role antibacterial agent (CHEBI:33282) |
| entrectinib (CHEBI:195558) has role antineoplastic agent (CHEBI:35610) |
| entrectinib (CHEBI:195558) has role apoptosis inducer (CHEBI:68495) |
| entrectinib (CHEBI:195558) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| entrectinib (CHEBI:195558) is a N-methylpiperazine (CHEBI:46920) |
| entrectinib (CHEBI:195558) is a benzamides (CHEBI:22702) |
| entrectinib (CHEBI:195558) is a difluorobenzene (CHEBI:38582) |
| entrectinib (CHEBI:195558) is a indazoles (CHEBI:38769) |
| entrectinib (CHEBI:195558) is a oxanes (CHEBI:46942) |
| entrectinib (CHEBI:195558) is a secondary amino compound (CHEBI:50995) |
| entrectinib (CHEBI:195558) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[5-(3,5-difluorobenzyl)-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-(tetrahydro-2H-pyran-4-ylamino)benzamide |
| INNs | Source |
|---|---|
| entrectinibum | WHO MedNet |
| entrectinib | WHO MedNet |
| entrectinib | WHO MedNet |
| entrectinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| RG6268 | ChEBI |
| NMS-E628 | ChEBI |
| RXDX 101 | ChEBI |
| NMS-E 628 | ChEBI |
| RG-6268 | ChEBI |
| RG 6268 | ChEBI |
| Brand Name | Source |
|---|---|
| Rozlytrek | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| Entrectinib | Wikipedia |
| DB11986 | DrugBank |
| D10926 | KEGG DRUG |
| HMDB0304880 | HMDB |
| YMX | PDBeChem |
| 24808589 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1108743-60-7 | ChEBI |
| Citations |
|---|