EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19N3O4S2 |
| Net Charge | 0 |
| Average Mass | 441.534 |
| Monoisotopic Mass | 441.08170 |
| SMILES | COc1cccc(CNc2ccc(S(=O)(=O)Nc3nc4ccccc4s3)cc2)c1O |
| InChI | InChI=1S/C21H19N3O4S2/c1-28-18-7-4-5-14(20(18)25)13-22-15-9-11-16(12-10-15)30(26,27)24-21-23-17-6-2-3-8-19(17)29-21/h2-12,22,25H,13H2,1H3,(H,23,24) |
| InChIKey | OWHBVKBNNRYMIN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 1.13.11.31 (arachidonate 12-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 12-lipoxygenase (EC 1.13.11.31). |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ML355 (CHEBI:195557) has functional parent 2-aminobenzothiazole (CHEBI:167751) |
| ML355 (CHEBI:195557) has role EC 1.13.11.31 (arachidonate 12-lipoxygenase) inhibitor (CHEBI:64995) |
| ML355 (CHEBI:195557) has role platelet aggregation inhibitor (CHEBI:50427) |
| ML355 (CHEBI:195557) is a benzothiazoles (CHEBI:37947) |
| ML355 (CHEBI:195557) is a monomethoxybenzene (CHEBI:25235) |
| ML355 (CHEBI:195557) is a phenols (CHEBI:33853) |
| ML355 (CHEBI:195557) is a secondary amino compound (CHEBI:50995) |
| ML355 (CHEBI:195557) is a substituted aniline (CHEBI:48975) |
| ML355 (CHEBI:195557) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-(1,3-benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxybenzyl)amino]benzenesulfonamide |
| Synonyms | Source |
|---|---|
| N-(1,3-benzothiazol-2-yl)-4-{[(2-hydroxy-3-methoxyphenyl)methyl]amino}benzene-1-sulfonamide | IUPAC |
| ML 355 | SUBMITTER |
| ML-355 | SUBMITTER |
| VLX 1005 | ChEBI |
| VLX-1005 | ChEBI |
| VLX1005 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ZR5 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1532593-30-8 | ChEBI |
| Citations |
|---|