EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22BN3O5 |
| Net Charge | 0 |
| Average Mass | 287.125 |
| Monoisotopic Mass | 287.16525 |
| SMILES | C[C@H](N)C(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C11H22BN3O5/c1-7(13)9(16)15-5-8(3-2-4-12(19)20)11(14,6-15)10(17)18/h7-8,19-20H,2-6,13-14H2,1H3,(H,17,18)/t7-,8-,11-/m0/s1 |
| InChIKey | ZZJLMZYUGLJBSO-LAEOZQHASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. EC 3.5.3.1 (arginase) inhibitor An EC 3.5.3.* (non-peptide linear amidine C-N hydrolase) inhibitor that interferes with the action of arginase (EC 3.5.3.1). |
| Applications: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| numidargistat (CHEBI:195556) has role antineoplastic agent (CHEBI:35610) |
| numidargistat (CHEBI:195556) has role EC 3.5.3.1 (arginase) inhibitor (CHEBI:195561) |
| numidargistat (CHEBI:195556) has role immunomodulator (CHEBI:50846) |
| numidargistat (CHEBI:195556) is a N-acylpyrrolidine (CHEBI:46766) |
| numidargistat (CHEBI:195556) is a amino monocarboxylic acid (CHEBI:52448) |
| numidargistat (CHEBI:195556) is a aminopyrrolidine (CHEBI:46769) |
| numidargistat (CHEBI:195556) is a boronic acids (CHEBI:38269) |
| numidargistat (CHEBI:195556) is a primary amino compound (CHEBI:50994) |
| numidargistat (CHEBI:195556) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| IUPAC Name |
|---|
| (3R,4S)-1-L-alanyl-3-amino-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| INNs | Source |
|---|---|
| numidargistat | WHO MedNet |
| numidargistat | WHO MedNet |
| numidargistat | WHO MedNet |
| numidargistatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (3R,4S)-3-amino-1-[(2S)-2-aminopropanoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid | IUPAC |
| CB 1158 | ChEBI |
| CB-1158 | SUBMITTER |
| CB1158 | ChEBI |
| INCB 001158 | ChEBI |
| INCB-001158 | ChEBI |
| Citations |
|---|