EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N |
| Net Charge | 0 |
| Average Mass | 101.193 |
| Monoisotopic Mass | 101.12045 |
| SMILES | CCCCC(C)N |
| InChI | InChI=1S/C6H15N/c1-3-4-5-6(2)7/h6H,3-5,7H2,1-2H3 |
| InChIKey | WGBBUURBHXLGFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hexanamine (CHEBI:195543) has parent hydride hexane (CHEBI:29021) |
| 2-hexanamine (CHEBI:195543) is a primary aliphatic amine (CHEBI:17062) |
| 2-hexanamine (CHEBI:195543) is conjugate base of hexan-2-aminium (CHEBI:195475) |
| Incoming Relation(s) |
| hexan-2-aminium (CHEBI:195475) is conjugate acid of 2-hexanamine (CHEBI:195543) |
| IUPAC Name |
|---|
| hexan-2-amine |
| Synonyms | Source |
|---|---|
| 1-methylpentylamine | NIST Chemistry WebBook |
| 2-aminohexane | NIST Chemistry WebBook |
| 2-hexanamine | NIST Chemistry WebBook |
| 2-hexylamine | NIST Chemistry WebBook |
| Citations |
|---|