EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N6O8 |
| Net Charge | 0 |
| Average Mass | 420.338 |
| Monoisotopic Mass | 420.10296 |
| SMILES | CNc1ccc(C(=O)Oc2cc(ON=[N+]([O-])N(C)C)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H16N6O8/c1-17-11-6-4-10(5-7-11)16(23)29-14-9-15(30-18-22(28)19(2)3)13(21(26)27)8-12(14)20(24)25/h4-9,17H,1-3H3 |
| InChIKey | DZJYJYAXGBNEMK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PABA/NO (CHEBI:195533) has role antineoplastic agent (CHEBI:35610) |
| PABA/NO (CHEBI:195533) has role apoptosis inducer (CHEBI:68495) |
| PABA/NO (CHEBI:195533) has role prodrug (CHEBI:50266) |
| PABA/NO (CHEBI:195533) is a C-nitro compound (CHEBI:35716) |
| PABA/NO (CHEBI:195533) is a azoxy compound (CHEBI:37390) |
| PABA/NO (CHEBI:195533) is a benzoate ester (CHEBI:36054) |
| PABA/NO (CHEBI:195533) is a secondary amino compound (CHEBI:50995) |
| PABA/NO (CHEBI:195533) is a triazene derivative (CHEBI:72573) |
| PABA/NO (CHEBI:195533) is a zwitterion (CHEBI:27369) |
| IUPAC Name |
|---|
| 5-[(3,3-dimethyl-2-oxido-2λ5-triaz-1-en-1-yl)oxy]-2,4-dinitrophenyl 4-(methylamino)benzoate |
| Synonyms | Source |
|---|---|
| PABA/NO | SUBMITTER |
| 5-[(3,3-dimethyl-2-oxido-1-triazen-1-yl)oxy]-2,4-dinitrophenyl 4-(methylamino)benzoate | ChEBI |
| O2-(2,4-dinitro-5-(4-(N-methylamino)benzoyloxy)phenyl) 1-(N,N-dimethylamino)diazen-1-ium-1,2-diolate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:875769-11-2 | SUBMITTER |
| Citations |
|---|