EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H22N2O4 |
| Net Charge | 0 |
| Average Mass | 426.472 |
| Monoisotopic Mass | 426.15796 |
| SMILES | COc1cccc(Oc2ccccc2NC(=O)CNC(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C26H22N2O4/c1-31-19-10-7-11-20(16-19)32-24-15-5-4-14-23(24)28-25(29)17-27-26(30)22-13-6-9-18-8-2-3-12-21(18)22/h2-16H,17H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | HDMONPHKMIZXDH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. PCNA inhibitor An inhibitor that interferes with the action of PCNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AOH1996 (CHEBI:195529) has role antineoplastic agent (CHEBI:35610) |
| AOH1996 (CHEBI:195529) has role apoptosis inducer (CHEBI:68495) |
| AOH1996 (CHEBI:195529) has role PCNA inhibitor (CHEBI:195530) |
| AOH1996 (CHEBI:195529) is a aromatic ether (CHEBI:35618) |
| AOH1996 (CHEBI:195529) is a diether (CHEBI:46786) |
| AOH1996 (CHEBI:195529) is a monomethoxybenzene (CHEBI:25235) |
| AOH1996 (CHEBI:195529) is a naphthalenecarboxamide (CHEBI:48739) |
| AOH1996 (CHEBI:195529) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-{2-[2-(3-methoxyphenoxy)anilino]-2-oxoethyl}naphthalene-1-carboxamide |
| Synonyms | Source |
|---|---|
| AOH 1996 | ChEBI |
| AOH-1996 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| AOH1996 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:2089314-64-5 | ChEBI |
| Citations |
|---|