EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21N5O3 |
| Net Charge | 0 |
| Average Mass | 391.431 |
| Monoisotopic Mass | 391.16444 |
| SMILES | COC(=O)c1nc2ccccc2c1/N=N/N1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C21H21N5O3/c1-29-21(28)20-19(15-5-2-3-6-16(15)22-20)23-24-25-10-13-9-14(12-25)17-7-4-8-18(27)26(17)11-13/h2-8,13-14,22H,9-12H2,1H3/b24-23+ |
| InChIKey | IXWNPEOFLGJGLY-WCWDXBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NPD6433 (CHEBI:195528) has role antifungal agent (CHEBI:35718) |
| NPD6433 (CHEBI:195528) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| NPD6433 (CHEBI:195528) is a bridged compound (CHEBI:35990) |
| NPD6433 (CHEBI:195528) is a indolyl carboxylate ester (CHEBI:46939) |
| NPD6433 (CHEBI:195528) is a methyl ester (CHEBI:25248) |
| NPD6433 (CHEBI:195528) is a organic heterocyclic compound (CHEBI:24532) |
| NPD6433 (CHEBI:195528) is a tertiary amino compound (CHEBI:50996) |
| NPD6433 (CHEBI:195528) is a triazene derivative (CHEBI:72573) |
| IUPAC Name |
|---|
| methyl 3-[(E)-(8-oxo-1,5,6,8-tetrahydro-2H-1,5-methanopyrido[1,2-a][1,5]diazocin-3(4H)-yl)diazenyl]-1H-indole-2-carboxylate |
| Citations |
|---|