EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H9IN2O2 |
| Net Charge | 0 |
| Average Mass | 388.164 |
| Monoisotopic Mass | 387.97088 |
| SMILES | O=C(O)c1nc2ccccc2c2nc3c(I)cccc3c12 |
| InChI | InChI=1S/C16H9IN2O2/c17-10-6-3-5-9-12-14(19-13(9)10)8-4-1-2-7-11(8)18-15(12)16(20)21/h1-7,19H,(H,20,21) |
| InChIKey | SDRAETFVRBBLOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.7.12.1 (dual-specificity kinase) inhibitor An EC 2.7.12.* [dual-specificity kinases (those acting on Ser/Thr and Tyr residues)] inhibitor that inhibits the action of dual-specificity kinase (EC 2.7.12.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KuFal194 (CHEBI:195522) has role EC 2.7.12.1 (dual-specificity kinase) inhibitor (CHEBI:195525) |
| KuFal194 (CHEBI:195522) is a indoloquinoline (CHEBI:195524) |
| KuFal194 (CHEBI:195522) is a monocarboxylic acid (CHEBI:25384) |
| KuFal194 (CHEBI:195522) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 10-iodo-11H-indolo[3,2-c]quinoline-6-carboxylic acid |
| Synonyms | Source |
|---|---|
| KuFal-194 | ChEBI |
| KuFal 194 | ChEBI |
| Dyrk1A-IN-5 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4E1 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1685235-41-9 | ChEBI |
| Citations |
|---|