EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14NO9 |
| Net Charge | -3 |
| Average Mass | 352.275 |
| Monoisotopic Mass | 352.06850 |
| SMILES | C=C(O[C@H]1C=CC=C(C(=O)[O-])[C@@H]1O)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C15H17NO9/c1-7(13(20)16-9(15(23)24)5-6-11(17)18)25-10-4-2-3-8(12(10)19)14(21)22/h2-4,9-10,12,19H,1,5-6H2,(H,16,20)(H,17,18)(H,21,22)(H,23,24)/p-3/t9-,10-,12-/m0/s1 |
| InChIKey | SYHKPNAMUNWTOX-NHCYSSNCSA-K |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isochorismoyl-L-glutamate(3−) (CHEBI:195519) is a N-acyl-L-glutamic acid (CHEBI:21650) |
| isochorismoyl-L-glutamate(3−) (CHEBI:195519) is a tricarboxylic acid trianion (CHEBI:27092) |
| Synonym | Source |
|---|---|
| isochorismate-9-glutamate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| isochorismoyl-L-glutamate | UniProt |
| Citations |
|---|