EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H76N2O12 |
| Net Charge | 0 |
| Average Mass | 777.050 |
| Monoisotopic Mass | 776.53983 |
| SMILES | CCCN1C[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(O)C[C@H]1C |
| InChI | InChI=1S/C40H76N2O12/c1-15-17-42-21-22(3)33(44)40(11,48)29(16-2)52-36(46)26(7)32(53-30-20-39(10,49-14)34(45)27(8)51-30)25(6)35(38(9,47)19-23(42)4)54-37-31(43)28(41(12)13)18-24(5)50-37/h22-35,37,43-45,47-48H,15-21H2,1-14H3/t22-,23+,24+,25-,26+,27-,28-,29+,30-,31+,32-,33+,34-,35+,37-,38+,39+,40+/m0/s1 |
| InChIKey | VWAMTBXLZPEDQO-UZSBJOJWSA-N |
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamithromycin (CHEBI:195437) has role antibacterial drug (CHEBI:36047) |
| gamithromycin (CHEBI:195437) has role protein synthesis inhibitor (CHEBI:48001) |
| gamithromycin (CHEBI:195437) is a macrolide antibiotic (CHEBI:25105) |
| gamithromycin (CHEBI:195437) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| (2R,3S,4R,5S,8R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10-trihydroxy-3,5,8,10,12,14-hexamethyl-15-oxo-7-propyl-11-{[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy}-1-oxa-7-azacyclopentadecan-13-yl 2,6-dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranoside |
| INNs | Source |
|---|---|
| gamithromycin | WHO MedNet |
| gamithromycin | WHO MedNet |
| gamithromycinum | WHO MedNet |
| gamitromicina | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2R,3S,4R,5S,8R,10R,11R,12S,13S,14R)-13-[(2,6-Dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,8,10,12,14-hexamethyl-7-propyl-11-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-1-oxa-7-azacyclopentadecan-15-one | ChEBI |
| ML 1709460 | ChEBI |
| ML-1,709,460 | DrugBank |
| ML-1709460 | DrugBank |
| ML-460 | DrugBank |
| Brand Name | Source |
|---|---|
| Zactran | ChEBI |
| Citations |
|---|