EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17NO5 |
| Net Charge | 0 |
| Average Mass | 267.281 |
| Monoisotopic Mass | 267.11067 |
| SMILES | CC(C)Oc1ccccc1OC(=O)NCCC(=O)O |
| InChI | InChI=1S/C13H17NO5/c1-9(2)18-10-5-3-4-6-11(10)19-13(17)14-8-7-12(15)16/h3-6,9H,7-8H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | MIHYPQCFVORQIK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PRNP (CHEBI:195435) has role hapten (CHEBI:59174) |
| PRNP (CHEBI:195435) is a aromatic ether (CHEBI:35618) |
| PRNP (CHEBI:195435) is a carbamate ester (CHEBI:23003) |
| PRNP (CHEBI:195435) is a monocarboxylic acid (CHEBI:25384) |
| PRNP (CHEBI:195435) is a β-alanine derivative (CHEBI:22823) |
| IUPAC Name |
|---|
| N-{[2-(propan-2-yloxy)phenoxy]carbonyl}-β-alanine |
| Synonyms | Source |
|---|---|
| 3-[[(2-isopropoxyphenyloxy)carbonyl]amino]propanoic acid | ChEBI |
| 3-({[2-(propan-2-yloxy)phenoxy]carbonyl}amino)propanoic acid | IUPAC |
| Citations |
|---|