EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO5 |
| Net Charge | 0 |
| Average Mass | 281.308 |
| Monoisotopic Mass | 281.12632 |
| SMILES | CC(C)Oc1ccccc1OC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C14H19NO5/c1-10(2)19-11-6-3-4-7-12(11)20-14(18)15-9-5-8-13(16)17/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | IHYRJPUIYAYCHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PRNB (CHEBI:195434) has role hapten (CHEBI:59174) |
| PRNB (CHEBI:195434) is a aromatic ether (CHEBI:35618) |
| PRNB (CHEBI:195434) is a carbamate ester (CHEBI:23003) |
| PRNB (CHEBI:195434) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 4-({[2-(propan-2-yloxy)phenoxy]carbonyl}amino)butanoic acid |
| Synonym | Source |
|---|---|
| 4-[[(2-isopropoxyphenyloxy)carbonyl]amino]butanoic acid | ChEBI |
| Citations |
|---|