EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO5 |
| Net Charge | 0 |
| Average Mass | 293.319 |
| Monoisotopic Mass | 293.12632 |
| SMILES | CC1(C)Cc2cccc(OC(=O)NCCCC(=O)O)c2O1 |
| InChI | InChI=1S/C15H19NO5/c1-15(2)9-10-5-3-6-11(13(10)21-15)20-14(19)16-8-4-7-12(17)18/h3,5-6H,4,7-9H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | KRLRNENWNQPSPG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BFNB (CHEBI:195433) has role hapten (CHEBI:59174) |
| BFNB (CHEBI:195433) is a 1-benzofurans (CHEBI:38830) |
| BFNB (CHEBI:195433) is a carbamate ester (CHEBI:23003) |
| BFNB (CHEBI:195433) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 4-({[(2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl)oxy]carbonyl}amino)butanoic acid |
| Synonym | Source |
|---|---|
| 4-[[(2,3-dihydro-2,2-dimethyl-7-benzofuranyloxy)carbonyl]-amino]butanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 67162249 | ChemSpider |
| Citations |
|---|