EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO5 |
| Net Charge | 0 |
| Average Mass | 279.292 |
| Monoisotopic Mass | 279.11067 |
| SMILES | CC1(C)Cc2cccc(OC(=O)NCCC(=O)O)c2O1 |
| InChI | InChI=1S/C14H17NO5/c1-14(2)8-9-4-3-5-10(12(9)20-14)19-13(18)15-7-6-11(16)17/h3-5H,6-8H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | GMBLQOVJCJHRLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BFNP (CHEBI:195432) has role hapten (CHEBI:59174) |
| BFNP (CHEBI:195432) is a 1-benzofurans (CHEBI:38830) |
| BFNP (CHEBI:195432) is a carbamate ester (CHEBI:23003) |
| BFNP (CHEBI:195432) is a monocarboxylic acid (CHEBI:25384) |
| BFNP (CHEBI:195432) is a β-alanine derivative (CHEBI:22823) |
| IUPAC Name |
|---|
| N-{[(2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl)oxy]carbonyl}-β-alanine |
| Synonyms | Source |
|---|---|
| 3-({[(2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl)oxy]carbonyl}amino)propanoic acid | IUPAC |
| 3-[[(2,3-dihydro-2,2-dimethyl-7-benzofuranyloxy)carbonyl]-amino]propanoic acid | ChEBI |
| Citations |
|---|