EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23NO4S |
| Net Charge | 0 |
| Average Mass | 325.430 |
| Monoisotopic Mass | 325.13478 |
| SMILES | CSc1c(C)cc(OC(=O)NCCCCCC(=O)O)cc1C |
| InChI | InChI=1S/C16H23NO4S/c1-11-9-13(10-12(2)15(11)22-3)21-16(20)17-8-6-4-5-7-14(18)19/h9-10H,4-8H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | PSMYXMORWQMSRL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MXNH (CHEBI:195428) has role hapten (CHEBI:59174) |
| MXNH (CHEBI:195428) is a aryl sulfide (CHEBI:35683) |
| MXNH (CHEBI:195428) is a carbamate ester (CHEBI:23003) |
| MXNH (CHEBI:195428) is a methyl sulfide (CHEBI:86315) |
| MXNH (CHEBI:195428) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 6-({[3,5-dimethyl-4-(methylsulfanyl)phenoxy]carbonyl}amino)hexanoic acid |
| Synonyms | Source |
|---|---|
| 6-[[1-(4-(methylthio)-3,5-xylyloxy)carbonyl]amino]hexanoic acid | ChEBI |
| 6-({[3,5-dimethyl-4-(methylthio)phenoxy]carbonyl}amino)hexanoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 9005220 | ChemSpider |