EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H11NO7 |
| Net Charge | 0 |
| Average Mass | 341.275 |
| Monoisotopic Mass | 341.05355 |
| SMILES | O=C(O)c1cc2cc(O)c(O)cc2c(C(=O)c2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C17H11NO7/c19-11-2-1-7(4-12(11)20)16(23)15-9-6-14(22)13(21)5-8(9)3-10(18-15)17(24)25/h1-6,19-22H,(H,24,25) |
| InChIKey | ZCMFEWUYBFMLIN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | insulin-like growth factor-binding protein inhibitor Any inhibitor that acts on insulin-like growth factor-binding proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NBI-31772 (CHEBI:195417) has role insulin-like growth factor-binding protein inhibitor (CHEBI:195444) |
| NBI-31772 (CHEBI:195417) is a aromatic ketone (CHEBI:76224) |
| NBI-31772 (CHEBI:195417) is a benzenediols (CHEBI:33570) |
| NBI-31772 (CHEBI:195417) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| NBI-31772 (CHEBI:195417) is a isoquinolines (CHEBI:24922) |
| NBI-31772 (CHEBI:195417) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 1-(3,4-dihydroxybenzoyl)-6,7-dihydroxyisoquinoline-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1-(3,4-dihydroxybenzoyl)-6,7-dihydroxy-3-isoquinolinecarboxylic acid | SUBMITTER |
| NBI31772 | ChEBI |
| NBI 31772 | ChEBI |
| 1-(3',4'-dihydroxybenzoyl)-6,7-dihydroxyisoquinoline-3-carboxylic acid | ChEBI |
| 6,7-dihydroxy-1-(3,4-dihydroxybenzoyl)isoquinoline-3-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 21379078 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:374620-70-9 | ChEBI |
| Citations |
|---|