EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H80N2O13 |
| Net Charge | 0 |
| Average Mass | 869.147 |
| Monoisotopic Mass | 868.56604 |
| SMILES | CC[C@H]1OC(=O)C[C@@H](O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)[C@@H](O)[C@H](N(C)C)[C@H]2O)[C@@H](CCN2C[C@H](C)C[C@H](C)C2)C[C@@H](C)C(=O)/C=C/C(C)=C/[C@@H]1CO[C@@H]1O[C@H](C)[C@@H](O)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C46H80N2O13/c1-13-36-33(24-57-46-44(56-12)43(55-11)40(53)31(8)59-46)19-25(2)14-15-34(49)28(5)20-32(16-17-48-22-26(3)18-27(4)23-48)42(29(6)35(50)21-37(51)60-36)61-45-41(54)38(47(9)10)39(52)30(7)58-45/h14-15,19,26-33,35-36,38-46,50,52-54H,13,16-18,20-24H2,1-12H3/b15-14+,25-19+/t26-,27+,28-,29+,30-,31-,32+,33-,35-,36-,38+,39-,40-,41-,42-,43-,44-,45+,46-/m1/s1 |
| InChIKey | JTSDBFGMPLKDCD-XVFHVFLVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilmicosin (CHEBI:195409) has role antibacterial drug (CHEBI:36047) |
| tilmicosin (CHEBI:195409) has role calcium channel blocker (CHEBI:38215) |
| tilmicosin (CHEBI:195409) has role cardiotoxic agent (CHEBI:50912) |
| tilmicosin (CHEBI:195409) is a enone (CHEBI:51689) |
| tilmicosin (CHEBI:195409) is a macrolide antibiotic (CHEBI:25105) |
| tilmicosin (CHEBI:195409) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| [(2R,3R,4E,6E,9R,11R,12S,13S,14R)-12-{[3,6-dideoxy-3-(dimethylamino)-β-D-glucopyranosyl]oxy}-11-{2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]ethyl}-2-ethyl-14-hydroxy-5,9,13-trimethyl-8,16-dioxo-1-oxacyclohexadeca-4,6-dien-3-yl]methyl 6-deoxy-2,3-di-O-methyl-β-D-allopyranoside |
| INNs | Source |
|---|---|
| tilmicosina | WHO MedNet |
| tilmicosine | WHO MedNet |
| tilmicosinum | WHO MedNet |
| tilmicosin | WHO MedNet |
| Synonyms | Source |
|---|---|
| EL-870 | DrugBank |
| EL 870 | ChEBI |
| LY 177370 | ChEBI |
| LY-177370 | DrugBank |
| EL870 | DrugBank |
| LY177370 | DrugBank |
| Brand Name | Source |
|---|---|
| Micotil | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB11471 | DrugBank |
| Tilmicosin | Wikipedia |
| D02492 | KEGG DRUG |
| 4445656 | ChemSpider |
| 1856 | VSDB |
| Registry Numbers | Sources |
|---|---|
| CAS:108050-54-0 | DrugBank |
| Citations |
|---|