EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H22O |
| Net Charge | 0 |
| Average Mass | 158.285 |
| Monoisotopic Mass | 158.16707 |
| SMILES | CCCCCCCC(O)CC |
| InChI | InChI=1S/C10H22O/c1-3-5-6-7-8-9-10(11)4-2/h10-11H,3-9H2,1-2H3 |
| InChIKey | ICEQLCZWZXUUIJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (26999795) | |
| Clibanarius vittatus (ncbitaxon:6751) | hemolymph (BTO:0000572) | DOI (10.1016/j.jembe.2009.10.001) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decan-3-ol (CHEBI:195405) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| decan-3-ol (CHEBI:195405) has role animal metabolite (CHEBI:75767) |
| decan-3-ol (CHEBI:195405) has role flavouring agent (CHEBI:35617) |
| decan-3-ol (CHEBI:195405) has role pheromone (CHEBI:26013) |
| decan-3-ol (CHEBI:195405) is a decanol (CHEBI:195598) |
| decan-3-ol (CHEBI:195405) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| decan-3-ol |
| Synonyms | Source |
|---|---|
| 1-ethyl-1-octanol | ChEBI |
| 3-decanol | ChEBI |
| 3-hydroxydecane | SUBMITTER |
| ethyl heptyl carbinol | ChEBI |
| FEMA 3605 | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-decanol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| FDB003482 | FooDB |
| HMDB0031408 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1565-81-7 | NIST Chemistry WebBook |
| Citations |
|---|