EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O3 |
| Net Charge | -1 |
| Average Mass | 317.449 |
| Monoisotopic Mass | 317.21222 |
| SMILES | CC/C=C\C/C=C\C[C@H](O)/C=C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h3-4,7-11,13-14,17,19,21H,2,5-6,12,15-16,18H2,1H3,(H,22,23)/p-1/b4-3-,9-7-,11-8-,13-10-,17-14+/t19-/m0/s1 |
| InChIKey | MCRJLMXYVFDXLS-UOLHMMFFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12(S)-HEPE(1−) (CHEBI:195401) is a HEPE(1−) (CHEBI:131874) |
| 12(S)-HEPE(1−) (CHEBI:195401) is conjugate base of 12(S)-HEPE (CHEBI:88345) |
| Incoming Relation(s) |
| 12(S)-HEPE (CHEBI:88345) is conjugate acid of 12(S)-HEPE(1−) (CHEBI:195401) |
| UniProt Name | Source |
|---|---|
| (12S)-hydroxy-(5Z,8Z,10E,14Z,17Z)-eicosapentaenoate | UniProt |
| Citations |
|---|