EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O3 |
| Net Charge | -1 |
| Average Mass | 317.449 |
| Monoisotopic Mass | 317.21222 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h3-4,6-7,9-10,12-14,16,19,21H,2,5,8,11,15,17-18H2,1H3,(H,22,23)/p-1/b4-3-,7-6-,10-9-,13-12-,16-14+/t19-/m1/s1 |
| InChIKey | FTAGQROYQYQRHF-GHWNLOBHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5(S)-HEPE(1−) (CHEBI:195400) is a HEPE(1−) (CHEBI:131874) |
| 5(S)-HEPE(1−) (CHEBI:195400) is conjugate base of 5S-HEPE (CHEBI:140934) |
| Incoming Relation(s) |
| 5S-HEPE (CHEBI:140934) is conjugate acid of 5(S)-HEPE(1−) (CHEBI:195400) |
| UniProt Name | Source |
|---|---|
| (5S)-hydroxy-(6E,8Z,11Z,14Z,17Z)-eicosapentaenoate | UniProt |
| Citations |
|---|