EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31N3O4S2 |
| Net Charge | 0 |
| Average Mass | 477.652 |
| Monoisotopic Mass | 477.17560 |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)[C@H](CSc1cccs1)C(=O)NO |
| InChI | InChI=1S/C23H31N3O4S2/c1-15(2)12-17(18(22(28)26-30)14-32-20-10-7-11-31-20)21(27)25-19(23(29)24-3)13-16-8-5-4-6-9-16/h4-11,15,17-19,30H,12-14H2,1-3H3,(H,24,29)(H,25,27)(H,26,28)/t17-,18+,19+/m1/s1 |
| InChIKey | XFILPEOLDIKJHX-QYZOEREBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| batimastat (CHEBI:195398) has role angiogenesis inhibitor (CHEBI:48422) |
| batimastat (CHEBI:195398) has role antineoplastic agent (CHEBI:35610) |
| batimastat (CHEBI:195398) has role matrix metalloproteinase inhibitor (CHEBI:50664) |
| batimastat (CHEBI:195398) is a L-phenylalanine derivative (CHEBI:84144) |
| batimastat (CHEBI:195398) is a hydroxamic acid (CHEBI:24650) |
| batimastat (CHEBI:195398) is a organic sulfide (CHEBI:16385) |
| batimastat (CHEBI:195398) is a secondary carboxamide (CHEBI:140325) |
| batimastat (CHEBI:195398) is a thiophenes (CHEBI:26961) |
| batimastat (CHEBI:195398) is a triamide (CHEBI:51954) |
| IUPAC Name |
|---|
| (2R,3S)-N4-hydroxy-N1-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-2-(2-methylpropyl)-3-[(thiophen-2-ylsulfanyl)methyl]butanediamide |
| INNs | Source |
|---|---|
| batimastat | WHO MedNet |
| batimastat | WHO MedNet |
| batimastat | WHO MedNet |
| batimastatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2R,3S)-N4-hydroxy-N1-[(1S)-2-(methylamino)-2-oxo-1-(phenylmethyl)ethyl]-2-(2-methylpropyl)-3-[(2-thienylthio)methyl]butanediamide | ChEBI |
| 4-(N-hydroxyamino)-2R-isobutyl-3S-(thiopen-2-ylthiomethyl)-succinyl-L-phenylalanine-N-methylamide | ChEBI |
| BB 94 | ChEBI |
| BB-94 | SUBMITTER |
| BB94 | DrugBank |
| Citations |
|---|