EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O |
| Net Charge | 0 |
| Average Mass | 112.172 |
| Monoisotopic Mass | 112.08882 |
| SMILES | CC1CCC(=O)CC1 |
| InChI | InChI=1S/C7H12O/c1-6-2-4-7(8)5-3-6/h6H,2-5H2,1H3 |
| InChIKey | VGVHNLRUAMRIEW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylcyclohexanone (CHEBI:195392) has role flavouring agent (CHEBI:35617) |
| 4-methylcyclohexanone (CHEBI:195392) has role plant metabolite (CHEBI:76924) |
| 4-methylcyclohexanone (CHEBI:195392) is a cyclohexanones (CHEBI:23482) |
| IUPAC Name |
|---|
| 4-methylcyclohexanone |
| Synonyms | Source |
|---|---|
| 4-methyl-1-cyclohexanone | ChEBI |
| p-methylcyclohexanone | NIST Chemistry WebBook |
| para-methylcyclohexanone | NIST Chemistry WebBook |
| 4-methylcyclohexane-1-one | ChEBI |
| 4-methyl-1-oxocyclohexane | ChEBI |
| 4-methyl-cyclohexan-1-one | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-methylcyclohexanone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00050722 | KNApSAcK |
| HMDB0031540 | HMDB |
| FDB008150 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:506746 | Reaxys |
| CAS:589-92-4 | NIST Chemistry WebBook |
| Citations |
|---|