EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O |
| Net Charge | 0 |
| Average Mass | 112.172 |
| Monoisotopic Mass | 112.08882 |
| SMILES | CC1CCCCC1=O |
| InChI | InChI=1S/C7H12O/c1-6-4-2-3-5-7(6)8/h6H,2-5H2,1H3 |
| InChIKey | LFSAPCRASZRSKS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | - | DOI (10.1016/S0308-8146(00)00187-4) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylcyclohexanone (CHEBI:195390) has role flavouring agent (CHEBI:35617) |
| 2-methylcyclohexanone (CHEBI:195390) has role plant metabolite (CHEBI:76924) |
| 2-methylcyclohexanone (CHEBI:195390) is a cyclohexanones (CHEBI:23482) |
| IUPAC Name |
|---|
| 2-methylcyclohexanone |
| Synonyms | Source |
|---|---|
| 2-methyl-1-cyclohexanone | ChEBI |
| 2-methylcyclohexan-1-one | ChEBI |
| 2-methylcyclohexane-1-one | ChEBI |
| o-methylcyclohexanone | ChEBI |
| ortho-methylcyclohexanone | ChEBI |
| FEMA 3946 | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methylcyclohexanone | UniProt |
| Citations |
|---|