EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO4 |
| Net Charge | 0 |
| Average Mass | 343.423 |
| Monoisotopic Mass | 343.17836 |
| SMILES | COc1ccc(CC2NCCc3cc(OC)c(OC)cc32)cc1OC |
| InChI | InChI=1S/C20H25NO4/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16/h5-6,10-12,16,21H,7-9H2,1-4H3 |
| InChIKey | YXWQTVWJNHKSCC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (CHEBI:195380) is a aromatic ether (CHEBI:35618) |
| 1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (CHEBI:195380) is a benzylisoquinoline alkaloid (CHEBI:22750) |
| 1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (CHEBI:195380) is a benzyltetrahydroisoquinoline (CHEBI:26901) |
| 1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (CHEBI:195380) is a polyether (CHEBI:46774) |
| 1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (CHEBI:195380) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| (R)-tetrahydropapaverine (CHEBI:136735) is a 1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (CHEBI:195380) |
| (S)-tetrahydropapaverine (CHEBI:195379) is a 1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (CHEBI:195380) |
| IUPAC Name |
|---|
| 1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
| Synonyms | Source |
|---|---|
| 1,2,3,4-tetrahydropapaverine | ChEBI |
| tetrahydropapaverine | ChEBI |
| 1-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-6,7-dimethoxyisoquinoline | ChEBI |