EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O2 |
| Net Charge | 0 |
| Average Mass | 310.522 |
| Monoisotopic Mass | 310.28718 |
| SMILES | [H]C(CC)=C([H])CCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4H,2,5-19H2,1H3,(H,21,22) |
| InChIKey | ZOKDQRULUYMUFA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-icosenoic acid (CHEBI:195361) is a icosenoic acid (CHEBI:23902) |
| Incoming Relation(s) |
| (17Z)-icosenoic acid (CHEBI:180274) is a 17-icosenoic acid (CHEBI:195361) |
| IUPAC Name |
|---|
| icos-17-enoic acid |
| Synonyms | Source |
|---|---|
| C20:1ω3 | ChEBI |
| 17-eicosenoic acid | ChEBI |
| FA 20:1n-3 | ChEBI |