EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O2 |
| Net Charge | 0 |
| Average Mass | 285.347 |
| Monoisotopic Mass | 285.14773 |
| SMILES | CN(C)CCc1ccccc1/N=N\c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H19N3O2/c1-19(2)10-9-12-5-3-4-6-14(12)18-17-13-7-8-15(20)16(21)11-13/h3-8,11,20-21H,9-10H2,1-2H3/b18-17- |
| InChIKey | FETKAENABYQSKW-ZCXUNETKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Application: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-azodopa (CHEBI:195341) is a azodopa (CHEBI:195323) |
| IUPAC Name |
|---|
| 4-[(Z)-{2-[2-(dimethylamino)ethyl]phenyl}diazenyl]benzene-1,2-diol |
| Synonym | Source |
|---|---|
| (Z)-azodopa | ChEBI |
| Citations |
|---|